What is the correct match of elements and atomic weights?
Ar=40(i), Cu=63.5(ii), Zn=65.5(iii), K=39(iv). Match: A-i B-ii C-iii D-iv.
The molecular formula of silver chromate is
Choose the correct answer.
Ag+ has valency 1; chromate CrO42- has valency 2 — criss-cross gives Ag2CrO4.
The molecular formula of calcium nitrite is
Choose the correct answer.
Ca2+ has valency 2; nitrite NO2- has valency 1 — criss-cross gives Ca(NO2)2.
The relative atomic mass of C in Na2CO3 is
Choose the correct answer.
The relative atomic mass of carbon is always 12 regardless of the compound it is in.
The formulas of sodium hypochlorite; potassium thiosulfate; and sodium dichromate are respectively
Choose the correct answer.
Hypochlorite=ClO-, Thiosulfate=S2O32-, Dichromate=Cr2O72-. Na and K are monovalent.
The relative atomic mass of sodium is
Choose the correct answer.
Relative atomic mass is a dimensionless ratio — it has no unit.
The number of electrons in an atom of an element is equal to its
Choose the correct answer.
In a neutral atom: electrons = protons = atomic number.
The relative atomic mass of chlorine is
Choose the correct answer.
Chlorine exists as 75% Cl-35 and 25% Cl-37. Weighted average = (75×35 + 25×37)/100 = 35.5
What is the correct match of elements and atomic weights? (S=32, Cl=35.5, Zn=65.5, P=31)
Choose the correct matching.
S=32(not listed in options — note: i=31 is P). Cl=35.5(iv), Zn=65.5(iii), P=31(i). Match: B-iv C-iii D-i.
According to IUPAC; atomic mass is expressed in terms of
Choose the correct answer.
IUPAC adopted C-12 as the standard reference isotope in 1961.
A symbol not only represents the name of the element but also its
Choose the correct answer.
By convention a chemical symbol represents the element name and its atomic mass.
The molecular formulas of sodium bicarbonate; sodium carbonate; magnesium nitrite; and magnesium nitrate are respectively
Choose the correct answer.
Na is monovalent. Mg is divalent. Bicarbonate=HCO3-, Carbonate=CO32-, Nitrite=NO2-, Nitrate=NO3-.
Which pair of formulae is correct? (Ca/Na/NH4/Mg set)
Choose the correct answer.
NH4+ valency 1: NH4HCO3 correct. K+ valency 1 and SO42- valency 2: K2SO4 correct.
The radicals present in sodium thiosulfate are
Choose the correct answer.
Sodium thiosulfate is Na2S2O3. Na+ valency=1, S2O32- valency=2, so 2 Na+ per 1 S2O32-.
The formulas of sulphite; sulphate; bisulphate; and bisulphite are respectively
Choose the correct answer.
Bisulphate = HSO4- (not thiosulphate S2O32-). Bisulphite = HSO3-.
The molecular formulas of silver chloride; ferrous carbonate; and cupric nitrate are respectively
Choose the correct answer.
Ag+=1, Cl-=1 → AgCl. Fe2+(ferrous)+CO32-=FeCO3. Cu2+(cupric)+NO3-=Cu(NO3)2.
Which pair of formulae is correct? (Ag/NH4/K/Zn set)
Ag+ valency 1: AgHCO3 correct. K+ valency 1: K3PO4 correct (PO43- valency 3).
Which of the following is not a chemical change?
Choose the correct answer.
Sublimation is a physical change (change of state from solid to gas). No new substance is formed.
The formulas of sulphite; thiosulphate; chlorate; and perchlorate are respectively
Choose the correct answer.
Sulphite=SO32-, Thiosulphate=S2O32-, Chlorate=ClO3-, Perchlorate=ClO4-.
Which process is a chemical change?
Choose the correct answer.
Cooking an egg causes irreversible chemical reactions (protein denaturation). The others are physical changes.
Relative atomic mass is
Choose the correct definition.
The IUPAC standard uses C-12 as the reference isotope.